About 1,2,3-trimethylpyridin-1-ium;hydrobromide
1,2,3-trimethylpyridin-1-ium;hydrobromide (PubChem CID 18985420) has the molecular formula C8H13BrN+
and a molecular weight of 203.10 g/mol. Its IUPAC name is 1,2,3-trimethylpyridin-1-ium;hydrobromide.
Molecular Properties
| Compound Name | 1,2,3-trimethylpyridin-1-ium;hydrobromide |
| PubChem CID | 18985420 |
| Molecular Formula | C8H13BrN+ |
| Molecular Weight | 203.10 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | 1,2,3-trimethylpyridin-1-ium;hydrobromide |
| SMILES | Br.Cc1ccc[n+](C)c1C |
| InChI | InChI=1S/C8H12N.BrH/c1-7-5-4-6-9(3)8(7)2;/h4-6H,1-3H3;1H/q+1; |
| InChIKey | BAUHCOVJMSUSOW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.10 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-trimethylpyridin-1-ium;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trimethylpyridin-1-ium;hydrobromide?
The IUPAC name of 1,2,3-trimethylpyridin-1-ium;hydrobromide (CID 18985420) is 1,2,3-trimethylpyridin-1-ium;hydrobromide.
What is the SMILES notation for 1,2,3-trimethylpyridin-1-ium;hydrobromide?
The canonical SMILES for 1,2,3-trimethylpyridin-1-ium;hydrobromide is Br.Cc1ccc[n+](C)c1C.
What is the InChIKey of 1,2,3-trimethylpyridin-1-ium;hydrobromide?
The InChIKey is BAUHCOVJMSUSOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N.BrH/c1-7-5-4-6-9(3)8(7)2;/h4-6H,1-3H3;1H/q+1;.
What are the key properties of 1,2,3-trimethylpyridin-1-ium;hydrobromide?
1,2,3-trimethylpyridin-1-ium;hydrobromide has a molecular weight of 203.10 g/mol, XLogP of 1.71, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trimethylpyridin-1-ium;hydrobromide is sourced from PubChem (CID 18985420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).