About 2-[4-(1-azabicyclo[2.2.2]octan-3-ylmethoxy)phenyl]-1,3-benzoxazole;dihydrochloride
2-[4-(1-azabicyclo[2.2.2]octan-3-ylmethoxy)phenyl]-1,3-benzoxazole;dihydrochloride (PubChem CID 18986064) has the molecular formula C21H24Cl2N2O2
and a molecular weight of 407.34 g/mol. Its IUPAC name is 2-[4-(1-azabicyclo[2.2.2]octan-3-ylmethoxy)phenyl]-1,3-benzoxazole;dihydrochloride.
Molecular Properties
| Compound Name | 2-[4-(1-azabicyclo[2.2.2]octan-3-ylmethoxy)phenyl]-1,3-benzoxazole;dihydrochloride |
| PubChem CID | 18986064 |
| Molecular Formula | C21H24Cl2N2O2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 2-[4-(1-azabicyclo[2.2.2]octan-3-ylmethoxy)phenyl]-1,3-benzoxazole;dihydrochloride |
| SMILES | Cl.Cl.c1ccc2oc(-c3ccc(OCC4CN5CCC4CC5)cc3)nc2c1 |
| InChI | InChI=1S/C21H22N2O2.2ClH/c1-2-4-20-19(3-1)22-21(25-20)16-5-7-18(8-6-16)24-14-17-13-23-11-9-15(17)10-12-23;;/h1-8,15,17H,9-14H2;2*1H |
| InChIKey | NIRYAADHEPYJFM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(1-azabicyclo[2.2.2]octan-3-ylmethoxy)phenyl]-1,3-benzoxazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1-azabicyclo[2.2.2]octan-3-ylmethoxy)phenyl]-1,3-benzoxazole;dihydrochloride?
The IUPAC name of 2-[4-(1-azabicyclo[2.2.2]octan-3-ylmethoxy)phenyl]-1,3-benzoxazole;dihydrochloride (CID 18986064) is 2-[4-(1-azabicyclo[2.2.2]octan-3-ylmethoxy)phenyl]-1,3-benzoxazole;dihydrochloride.
What is the SMILES notation for 2-[4-(1-azabicyclo[2.2.2]octan-3-ylmethoxy)phenyl]-1,3-benzoxazole;dihydrochloride?
The canonical SMILES for 2-[4-(1-azabicyclo[2.2.2]octan-3-ylmethoxy)phenyl]-1,3-benzoxazole;dihydrochloride is Cl.Cl.c1ccc2oc(-c3ccc(OCC4CN5CCC4CC5)cc3)nc2c1.
What is the InChIKey of 2-[4-(1-azabicyclo[2.2.2]octan-3-ylmethoxy)phenyl]-1,3-benzoxazole;dihydrochloride?
The InChIKey is NIRYAADHEPYJFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O2.2ClH/c1-2-4-20-19(3-1)22-21(25-20)16-5-7-18(8-6-16)24-14-17-13-23-11-9-15(17)10-12-23;;/h1-8,15,17H,9-14H2;2*1H.
What are the key properties of 2-[4-(1-azabicyclo[2.2.2]octan-3-ylmethoxy)phenyl]-1,3-benzoxazole;dihydrochloride?
2-[4-(1-azabicyclo[2.2.2]octan-3-ylmethoxy)phenyl]-1,3-benzoxazole;dihydrochloride has a molecular weight of 407.34 g/mol, XLogP of 5.06, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1-azabicyclo[2.2.2]octan-3-ylmethoxy)phenyl]-1,3-benzoxazole;dihydrochloride is sourced from PubChem (CID 18986064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).