About (Z)-prop-1-ene-1,2-diamine
(Z)-prop-1-ene-1,2-diamine (PubChem CID 18986484) has the molecular formula C3H8N2
and a molecular weight of 72.11 g/mol. Its IUPAC name is (Z)-prop-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | (Z)-prop-1-ene-1,2-diamine |
| PubChem CID | 18986484 |
| Molecular Formula | C3H8N2 |
| Molecular Weight | 72.11 g/mol |
| Exact Mass | 72.07 |
| IUPAC Name | (Z)-prop-1-ene-1,2-diamine |
| SMILES | C/C(N)=C/N |
| InChI | InChI=1S/C3H8N2/c1-3(5)2-4/h2H,4-5H2,1H3/b3-2- |
| InChIKey | FDMXADMEKAUMIV-IHWYPQMZSA-N |
| XLogP | -0.23 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 72.11 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-prop-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-prop-1-ene-1,2-diamine?
The IUPAC name of (Z)-prop-1-ene-1,2-diamine (CID 18986484) is (Z)-prop-1-ene-1,2-diamine.
What is the SMILES notation for (Z)-prop-1-ene-1,2-diamine?
The canonical SMILES for (Z)-prop-1-ene-1,2-diamine is C/C(N)=C/N.
What is the InChIKey of (Z)-prop-1-ene-1,2-diamine?
The InChIKey is FDMXADMEKAUMIV-IHWYPQMZSA-N. The full InChI is InChI=1S/C3H8N2/c1-3(5)2-4/h2H,4-5H2,1H3/b3-2-.
What are the key properties of (Z)-prop-1-ene-1,2-diamine?
(Z)-prop-1-ene-1,2-diamine has a molecular weight of 72.11 g/mol, XLogP of -0.23, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-prop-1-ene-1,2-diamine is sourced from PubChem (CID 18986484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).