About (Z)-1-N,2-N-dimethylprop-1-ene-1,2-diamine
(Z)-1-N,2-N-dimethylprop-1-ene-1,2-diamine (PubChem CID 18986487) has the molecular formula C5H12N2
and a molecular weight of 100.16 g/mol. Its IUPAC name is (Z)-1-N,2-N-dimethylprop-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | (Z)-1-N,2-N-dimethylprop-1-ene-1,2-diamine |
| PubChem CID | 18986487 |
| Molecular Formula | C5H12N2 |
| Molecular Weight | 100.16 g/mol |
| Exact Mass | 100.10 |
| IUPAC Name | (Z)-1-N,2-N-dimethylprop-1-ene-1,2-diamine |
| SMILES | CN/C=C(/C)NC |
| InChI | InChI=1S/C5H12N2/c1-5(7-3)4-6-2/h4,6-7H,1-3H3/b5-4- |
| InChIKey | XORLZDPORAANRM-PLNGDYQASA-N |
| XLogP | 0.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.16 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (Z)-1-N,2-N-dimethylprop-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-N,2-N-dimethylprop-1-ene-1,2-diamine?
The IUPAC name of (Z)-1-N,2-N-dimethylprop-1-ene-1,2-diamine (CID 18986487) is (Z)-1-N,2-N-dimethylprop-1-ene-1,2-diamine.
What is the SMILES notation for (Z)-1-N,2-N-dimethylprop-1-ene-1,2-diamine?
The canonical SMILES for (Z)-1-N,2-N-dimethylprop-1-ene-1,2-diamine is CN/C=C(/C)NC.
What is the InChIKey of (Z)-1-N,2-N-dimethylprop-1-ene-1,2-diamine?
The InChIKey is XORLZDPORAANRM-PLNGDYQASA-N. The full InChI is InChI=1S/C5H12N2/c1-5(7-3)4-6-2/h4,6-7H,1-3H3/b5-4-.
What are the key properties of (Z)-1-N,2-N-dimethylprop-1-ene-1,2-diamine?
(Z)-1-N,2-N-dimethylprop-1-ene-1,2-diamine has a molecular weight of 100.16 g/mol, XLogP of 0.29, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-N,2-N-dimethylprop-1-ene-1,2-diamine is sourced from PubChem (CID 18986487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).