C22H12O4S2 — CID 18986998
7,18-dimethyl-2,13-dithiapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3(12),5(10),6,8,16(21),17,19-octaene-4,11,15,22-tetrone (PubChem CID 18986998) has the molecular formula C22H12O4S2 and a molecular weight of 404.47 g/mol. Its IUPAC name is 7,18-dimethyl-2,13-dithiapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3(12),5(10),6,8,16(21),17,19-octaene-4,11,15,22-tetrone.
| Compound Name | 7,18-dimethyl-2,13-dithiapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3(12),5(10),6,8,16(21),17,19-octaene-4,11,15,22-tetrone |
|---|---|
| PubChem CID | 18986998 |
| Molecular Formula | C22H12O4S2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 7,18-dimethyl-2,13-dithiapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3(12),5(10),6,8,16(21),17,19-octaene-4,11,15,22-tetrone |
| SMILES | Cc1ccc2c(=O)c3sc4c(=O)c5cc(C)ccc5c(=O)c4sc3c(=O)c2c1 |
| InChI | InChI=1S/C22H12O4S2/c1-9-3-5-11-13(7-9)17(25)21-19(15(11)23)28-22-18(26)14-8-10(2)4-6-12(14)16(24)20(22)27-21/h3-8H,1-2H3 |
| InChIKey | QRUYRSWXXHQBBI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|