C30H22N4O4 — CID 18987
4-(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)-1,2-diphenylpyrazolidine-3,5-dione (PubChem CID 18987) has the molecular formula C30H22N4O4 and a molecular weight of 502.53 g/mol. Its IUPAC name is 4-(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)-1,2-diphenylpyrazolidine-3,5-dione.
| Compound Name | 4-(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)-1,2-diphenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 18987 |
| Molecular Formula | C30H22N4O4 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 4-(3,5-dioxo-1,2-diphenylpyrazolidin-4-yl)-1,2-diphenylpyrazolidine-3,5-dione |
| SMILES | O=C1C(C2C(=O)N(c3ccccc3)N(c3ccccc3)C2=O)C(=O)N(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C30H22N4O4/c35-27-25(28(36)32(22-15-7-2-8-16-22)31(27)21-13-5-1-6-14-21)26-29(37)33(23-17-9-3-10-18-23)34(30(26)38)24-19-11-4-12-20-24/h1-20,25-26H |
| InChIKey | USKAVCMWCUTATL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|