About 2-(3,4-dihydroisoquinolin-1-yl)acetamide;hydrochloride
2-(3,4-dihydroisoquinolin-1-yl)acetamide;hydrochloride (PubChem CID 18987007) has the molecular formula C11H13ClN2O
and a molecular weight of 224.69 g/mol. Its IUPAC name is 2-(3,4-dihydroisoquinolin-1-yl)acetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-(3,4-dihydroisoquinolin-1-yl)acetamide;hydrochloride |
| PubChem CID | 18987007 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-(3,4-dihydroisoquinolin-1-yl)acetamide;hydrochloride |
| SMILES | Cl.NC(=O)CC1=NCCc2ccccc21 |
| InChI | InChI=1S/C11H12N2O.ClH/c12-11(14)7-10-9-4-2-1-3-8(9)5-6-13-10;/h1-4H,5-7H2,(H2,12,14);1H |
| InChIKey | PLIDEWHZCDNGJI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,4-dihydroisoquinolin-1-yl)acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydroisoquinolin-1-yl)acetamide;hydrochloride?
The IUPAC name of 2-(3,4-dihydroisoquinolin-1-yl)acetamide;hydrochloride (CID 18987007) is 2-(3,4-dihydroisoquinolin-1-yl)acetamide;hydrochloride.
What is the SMILES notation for 2-(3,4-dihydroisoquinolin-1-yl)acetamide;hydrochloride?
The canonical SMILES for 2-(3,4-dihydroisoquinolin-1-yl)acetamide;hydrochloride is Cl.NC(=O)CC1=NCCc2ccccc21.
What is the InChIKey of 2-(3,4-dihydroisoquinolin-1-yl)acetamide;hydrochloride?
The InChIKey is PLIDEWHZCDNGJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O.ClH/c12-11(14)7-10-9-4-2-1-3-8(9)5-6-13-10;/h1-4H,5-7H2,(H2,12,14);1H.
What are the key properties of 2-(3,4-dihydroisoquinolin-1-yl)acetamide;hydrochloride?
2-(3,4-dihydroisoquinolin-1-yl)acetamide;hydrochloride has a molecular weight of 224.69 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydroisoquinolin-1-yl)acetamide;hydrochloride is sourced from PubChem (CID 18987007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).