C19H16N4O2S3 — CID 18987042
N-[4-[(5E)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]anilino]formamide (PubChem CID 18987042) has the molecular formula C19H16N4O2S3 and a molecular weight of 428.56 g/mol. Its IUPAC name is N-[4-[(5E)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]anilino]formamide.
| Compound Name | N-[4-[(5E)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]anilino]formamide |
|---|---|
| PubChem CID | 18987042 |
| Molecular Formula | C19H16N4O2S3 |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | N-[4-[(5E)-5-(3-ethyl-1,3-benzothiazol-2-ylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]anilino]formamide |
| SMILES | CCN1/C(=C2\SC(=S)N(c3ccc(NNC=O)cc3)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C19H16N4O2S3/c1-2-22-14-5-3-4-6-15(14)27-18(22)16-17(25)23(19(26)28-16)13-9-7-12(8-10-13)21-20-11-24/h3-11,21H,2H2,1H3,(H,20,24)/b18-16+ |
| InChIKey | KPUCRHOKIBSYAM-FBMGVBCBSA-N |
| XLogP | 3.93 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|