About 4-(1,3-benzodioxol-5-yl)-2-[5-methyl-5-(2H-tetrazol-5-yl)hexoxy]-6-phenylpyridine
4-(1,3-benzodioxol-5-yl)-2-[5-methyl-5-(2H-tetrazol-5-yl)hexoxy]-6-phenylpyridine (PubChem CID 18987197) has the molecular formula C26H27N5O3
and a molecular weight of 457.53 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-[5-methyl-5-(2H-tetrazol-5-yl)hexoxy]-6-phenylpyridine.
Molecular Properties
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-[5-methyl-5-(2H-tetrazol-5-yl)hexoxy]-6-phenylpyridine |
| PubChem CID | 18987197 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-[5-methyl-5-(2H-tetrazol-5-yl)hexoxy]-6-phenylpyridine |
| SMILES | CC(C)(CCCCOc1cc(-c2ccc3c(c2)OCO3)cc(-c2ccccc2)n1)c1nn[nH]n1 |
| InChI | InChI=1S/C26H27N5O3/c1-26(2,25-28-30-31-29-25)12-6-7-13-32-24-16-20(14-21(27-24)18-8-4-3-5-9-18)19-10-11-22-23(15-19)34-17-33-22/h3-5,8-11,14-16H,6-7,12-13,17H2,1-2H3,(H,28,29,30,31) |
| InChIKey | WZWCUPSDHAIDBQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-benzodioxol-5-yl)-2-[5-methyl-5-(2H-tetrazol-5-yl)hexoxy]-6-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzodioxol-5-yl)-2-[5-methyl-5-(2H-tetrazol-5-yl)hexoxy]-6-phenylpyridine?
The IUPAC name of 4-(1,3-benzodioxol-5-yl)-2-[5-methyl-5-(2H-tetrazol-5-yl)hexoxy]-6-phenylpyridine (CID 18987197) is 4-(1,3-benzodioxol-5-yl)-2-[5-methyl-5-(2H-tetrazol-5-yl)hexoxy]-6-phenylpyridine.
What is the SMILES notation for 4-(1,3-benzodioxol-5-yl)-2-[5-methyl-5-(2H-tetrazol-5-yl)hexoxy]-6-phenylpyridine?
The canonical SMILES for 4-(1,3-benzodioxol-5-yl)-2-[5-methyl-5-(2H-tetrazol-5-yl)hexoxy]-6-phenylpyridine is CC(C)(CCCCOc1cc(-c2ccc3c(c2)OCO3)cc(-c2ccccc2)n1)c1nn[nH]n1.
What is the InChIKey of 4-(1,3-benzodioxol-5-yl)-2-[5-methyl-5-(2H-tetrazol-5-yl)hexoxy]-6-phenylpyridine?
The InChIKey is WZWCUPSDHAIDBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27N5O3/c1-26(2,25-28-30-31-29-25)12-6-7-13-32-24-16-20(14-21(27-24)18-8-4-3-5-9-18)19-10-11-22-23(15-19)34-17-33-22/h3-5,8-11,14-16H,6-7,12-13,17H2,1-2H3,(H,28,29,30,31).
What are the key properties of 4-(1,3-benzodioxol-5-yl)-2-[5-methyl-5-(2H-tetrazol-5-yl)hexoxy]-6-phenylpyridine?
4-(1,3-benzodioxol-5-yl)-2-[5-methyl-5-(2H-tetrazol-5-yl)hexoxy]-6-phenylpyridine has a molecular weight of 457.53 g/mol, XLogP of 5.18, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzodioxol-5-yl)-2-[5-methyl-5-(2H-tetrazol-5-yl)hexoxy]-6-phenylpyridine is sourced from PubChem (CID 18987197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).