About 6-[(5,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylhexanoic acid
6-[(5,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylhexanoic acid (PubChem CID 18987265) has the molecular formula C25H27NO3
and a molecular weight of 389.50 g/mol. Its IUPAC name is 6-[(5,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylhexanoic acid.
Molecular Properties
| Compound Name | 6-[(5,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylhexanoic acid |
| PubChem CID | 18987265 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 6-[(5,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylhexanoic acid |
| SMILES | CC(C)(CCCCOc1ccc(-c2ccccc2)c(-c2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C25H27NO3/c1-25(2,24(27)28)17-9-10-18-29-22-16-15-21(19-11-5-3-6-12-19)23(26-22)20-13-7-4-8-14-20/h3-8,11-16H,9-10,17-18H2,1-2H3,(H,27,28) |
| InChIKey | VTBOGYUTNIPLQB-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(5,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(5,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylhexanoic acid?
The IUPAC name of 6-[(5,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylhexanoic acid (CID 18987265) is 6-[(5,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylhexanoic acid.
What is the SMILES notation for 6-[(5,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylhexanoic acid?
The canonical SMILES for 6-[(5,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylhexanoic acid is CC(C)(CCCCOc1ccc(-c2ccccc2)c(-c2ccccc2)n1)C(=O)O.
What is the InChIKey of 6-[(5,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylhexanoic acid?
The InChIKey is VTBOGYUTNIPLQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27NO3/c1-25(2,24(27)28)17-9-10-18-29-22-16-15-21(19-11-5-3-6-12-19)23(26-22)20-13-7-4-8-14-20/h3-8,11-16H,9-10,17-18H2,1-2H3,(H,27,28).
What are the key properties of 6-[(5,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylhexanoic acid?
6-[(5,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylhexanoic acid has a molecular weight of 389.50 g/mol, XLogP of 6.08, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(5,6-diphenyl-2-pyridinyl)oxy]-2,2-dimethylhexanoic acid is sourced from PubChem (CID 18987265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).