About piperidin-4-yl 2-methylbutanoate
piperidin-4-yl 2-methylbutanoate (PubChem CID 18987401) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is piperidin-4-yl 2-methylbutanoate.
Molecular Properties
| Compound Name | piperidin-4-yl 2-methylbutanoate |
| PubChem CID | 18987401 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | piperidin-4-yl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CCNCC1 |
| InChI | InChI=1S/C10H19NO2/c1-3-8(2)10(12)13-9-4-6-11-7-5-9/h8-9,11H,3-7H2,1-2H3 |
| InChIKey | HQWTYCSAVHDRAU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidin-4-yl 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-yl 2-methylbutanoate?
The IUPAC name of piperidin-4-yl 2-methylbutanoate (CID 18987401) is piperidin-4-yl 2-methylbutanoate.
What is the SMILES notation for piperidin-4-yl 2-methylbutanoate?
The canonical SMILES for piperidin-4-yl 2-methylbutanoate is CCC(C)C(=O)OC1CCNCC1.
What is the InChIKey of piperidin-4-yl 2-methylbutanoate?
The InChIKey is HQWTYCSAVHDRAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-3-8(2)10(12)13-9-4-6-11-7-5-9/h8-9,11H,3-7H2,1-2H3.
What are the key properties of piperidin-4-yl 2-methylbutanoate?
piperidin-4-yl 2-methylbutanoate has a molecular weight of 185.27 g/mol, XLogP of 1.33, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-yl 2-methylbutanoate is sourced from PubChem (CID 18987401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).