C4H2F6O2 — CID 18987705
2,3,3,4,4,4-hexafluorobutanoic acid (PubChem CID 18987705) has the molecular formula C4H2F6O2 and a molecular weight of 196.05 g/mol. Its IUPAC name is 2,3,3,4,4,4-hexafluorobutanoic acid.
| Compound Name | 2,3,3,4,4,4-hexafluorobutanoic acid |
|---|---|
| PubChem CID | 18987705 |
| Molecular Formula | C4H2F6O2 |
| Molecular Weight | 196.05 g/mol |
| Exact Mass | 196.00 |
| IUPAC Name | 2,3,3,4,4,4-hexafluorobutanoic acid |
| SMILES | O=C(O)C(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H2F6O2/c5-1(2(11)12)3(6,7)4(8,9)10/h1H,(H,11,12) |
| InChIKey | YOCXVTUVGZFVTK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.05 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|