About 2,4-dimethylpentan-1-amine
2,4-dimethylpentan-1-amine (PubChem CID 18987919) has the molecular formula C7H17N
and a molecular weight of 115.22 g/mol. Its IUPAC name is 2,4-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 2,4-dimethylpentan-1-amine |
| PubChem CID | 18987919 |
| Molecular Formula | C7H17N |
| Molecular Weight | 115.22 g/mol |
| Exact Mass | 115.14 |
| IUPAC Name | 2,4-dimethylpentan-1-amine |
| SMILES | CC(C)CC(C)CN |
| InChI | InChI=1S/C7H17N/c1-6(2)4-7(3)5-8/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | VSCUUONOAFHEOJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpentan-1-amine?
The IUPAC name of 2,4-dimethylpentan-1-amine (CID 18987919) is 2,4-dimethylpentan-1-amine.
What is the SMILES notation for 2,4-dimethylpentan-1-amine?
The canonical SMILES for 2,4-dimethylpentan-1-amine is CC(C)CC(C)CN.
What is the InChIKey of 2,4-dimethylpentan-1-amine?
The InChIKey is VSCUUONOAFHEOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N/c1-6(2)4-7(3)5-8/h6-7H,4-5,8H2,1-3H3.
What are the key properties of 2,4-dimethylpentan-1-amine?
2,4-dimethylpentan-1-amine has a molecular weight of 115.22 g/mol, XLogP of 1.63, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpentan-1-amine is sourced from PubChem (CID 18987919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).