About [6-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl] acridine-9-carboxylate
[6-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl] acridine-9-carboxylate (PubChem CID 18987972) has the molecular formula C30H29NO3Si
and a molecular weight of 479.65 g/mol. Its IUPAC name is [6-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl] acridine-9-carboxylate.
Molecular Properties
| Compound Name | [6-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl] acridine-9-carboxylate |
| PubChem CID | 18987972 |
| Molecular Formula | C30H29NO3Si |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | [6-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl] acridine-9-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(OC(=O)c3c4ccccc4nc4ccccc34)cccc2c1 |
| InChI | InChI=1S/C30H29NO3Si/c1-30(2,3)35(4,5)34-21-17-18-22-20(19-21)11-10-16-27(22)33-29(32)28-23-12-6-8-14-25(23)31-26-15-9-7-13-24(26)28/h6-19H,1-5H3 |
| InChIKey | QCCUNRFUSPOGLR-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze [6-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl] acridine-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl] acridine-9-carboxylate?
The IUPAC name of [6-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl] acridine-9-carboxylate (CID 18987972) is [6-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl] acridine-9-carboxylate.
What is the SMILES notation for [6-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl] acridine-9-carboxylate?
The canonical SMILES for [6-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl] acridine-9-carboxylate is CC(C)(C)[Si](C)(C)Oc1ccc2c(OC(=O)c3c4ccccc4nc4ccccc34)cccc2c1.
What is the InChIKey of [6-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl] acridine-9-carboxylate?
The InChIKey is QCCUNRFUSPOGLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H29NO3Si/c1-30(2,3)35(4,5)34-21-17-18-22-20(19-21)11-10-16-27(22)33-29(32)28-23-12-6-8-14-25(23)31-26-15-9-7-13-24(26)28/h6-19H,1-5H3.
What are the key properties of [6-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl] acridine-9-carboxylate?
[6-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl] acridine-9-carboxylate has a molecular weight of 479.65 g/mol, XLogP of 8.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl] acridine-9-carboxylate is sourced from PubChem (CID 18987972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).