About 2-phosphorosobutanoic acid
2-phosphorosobutanoic acid (PubChem CID 18988008) has the molecular formula C4H7O3P
and a molecular weight of 134.07 g/mol. Its IUPAC name is 2-phosphorosobutanoic acid.
Molecular Properties
| Compound Name | 2-phosphorosobutanoic acid |
| PubChem CID | 18988008 |
| Molecular Formula | C4H7O3P |
| Molecular Weight | 134.07 g/mol |
| Exact Mass | 134.01 |
| IUPAC Name | 2-phosphorosobutanoic acid |
| SMILES | CCC(P=O)C(=O)O |
| InChI | InChI=1S/C4H7O3P/c1-2-3(8-7)4(5)6/h3H,2H2,1H3,(H,5,6) |
| InChIKey | XDIORMISNJPHQO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.07 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-phosphorosobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phosphorosobutanoic acid?
The IUPAC name of 2-phosphorosobutanoic acid (CID 18988008) is 2-phosphorosobutanoic acid.
What is the SMILES notation for 2-phosphorosobutanoic acid?
The canonical SMILES for 2-phosphorosobutanoic acid is CCC(P=O)C(=O)O.
What is the InChIKey of 2-phosphorosobutanoic acid?
The InChIKey is XDIORMISNJPHQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7O3P/c1-2-3(8-7)4(5)6/h3H,2H2,1H3,(H,5,6).
What are the key properties of 2-phosphorosobutanoic acid?
2-phosphorosobutanoic acid has a molecular weight of 134.07 g/mol, XLogP of 1.14, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phosphorosobutanoic acid is sourced from PubChem (CID 18988008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).