About 3-(7-methylimidazo[1,2-b]pyridazin-6-yl)sulfanylpropane-1-sulfonamide
3-(7-methylimidazo[1,2-b]pyridazin-6-yl)sulfanylpropane-1-sulfonamide (PubChem CID 18988139) has the molecular formula C10H14N4O2S2
and a molecular weight of 286.38 g/mol. Its IUPAC name is 3-(7-methylimidazo[1,2-b]pyridazin-6-yl)sulfanylpropane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-(7-methylimidazo[1,2-b]pyridazin-6-yl)sulfanylpropane-1-sulfonamide |
| PubChem CID | 18988139 |
| Molecular Formula | C10H14N4O2S2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 3-(7-methylimidazo[1,2-b]pyridazin-6-yl)sulfanylpropane-1-sulfonamide |
| SMILES | Cc1cc2nccn2nc1SCCCS(N)(=O)=O |
| InChI | InChI=1S/C10H14N4O2S2/c1-8-7-9-12-3-4-14(9)13-10(8)17-5-2-6-18(11,15)16/h3-4,7H,2,5-6H2,1H3,(H2,11,15,16) |
| InChIKey | KITPTCCSSIFHPP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(7-methylimidazo[1,2-b]pyridazin-6-yl)sulfanylpropane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(7-methylimidazo[1,2-b]pyridazin-6-yl)sulfanylpropane-1-sulfonamide?
The IUPAC name of 3-(7-methylimidazo[1,2-b]pyridazin-6-yl)sulfanylpropane-1-sulfonamide (CID 18988139) is 3-(7-methylimidazo[1,2-b]pyridazin-6-yl)sulfanylpropane-1-sulfonamide.
What is the SMILES notation for 3-(7-methylimidazo[1,2-b]pyridazin-6-yl)sulfanylpropane-1-sulfonamide?
The canonical SMILES for 3-(7-methylimidazo[1,2-b]pyridazin-6-yl)sulfanylpropane-1-sulfonamide is Cc1cc2nccn2nc1SCCCS(N)(=O)=O.
What is the InChIKey of 3-(7-methylimidazo[1,2-b]pyridazin-6-yl)sulfanylpropane-1-sulfonamide?
The InChIKey is KITPTCCSSIFHPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O2S2/c1-8-7-9-12-3-4-14(9)13-10(8)17-5-2-6-18(11,15)16/h3-4,7H,2,5-6H2,1H3,(H2,11,15,16).
What are the key properties of 3-(7-methylimidazo[1,2-b]pyridazin-6-yl)sulfanylpropane-1-sulfonamide?
3-(7-methylimidazo[1,2-b]pyridazin-6-yl)sulfanylpropane-1-sulfonamide has a molecular weight of 286.38 g/mol, XLogP of 0.81, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7-methylimidazo[1,2-b]pyridazin-6-yl)sulfanylpropane-1-sulfonamide is sourced from PubChem (CID 18988139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).