About (4,5-dipentyl-3,6-dihydro-2H-thiopyran-2-yl)methanol
(4,5-dipentyl-3,6-dihydro-2H-thiopyran-2-yl)methanol (PubChem CID 18988213) has the molecular formula C16H30OS
and a molecular weight of 270.48 g/mol. Its IUPAC name is (4,5-dipentyl-3,6-dihydro-2H-thiopyran-2-yl)methanol.
Molecular Properties
| Compound Name | (4,5-dipentyl-3,6-dihydro-2H-thiopyran-2-yl)methanol |
| PubChem CID | 18988213 |
| Molecular Formula | C16H30OS |
| Molecular Weight | 270.48 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (4,5-dipentyl-3,6-dihydro-2H-thiopyran-2-yl)methanol |
| SMILES | CCCCCC1=C(CCCCC)CC(CO)SC1 |
| InChI | InChI=1S/C16H30OS/c1-3-5-7-9-14-11-16(12-17)18-13-15(14)10-8-6-4-2/h16-17H,3-13H2,1-2H3 |
| InChIKey | DZOUMQWAHKHUET-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4,5-dipentyl-3,6-dihydro-2H-thiopyran-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,5-dipentyl-3,6-dihydro-2H-thiopyran-2-yl)methanol?
The IUPAC name of (4,5-dipentyl-3,6-dihydro-2H-thiopyran-2-yl)methanol (CID 18988213) is (4,5-dipentyl-3,6-dihydro-2H-thiopyran-2-yl)methanol.
What is the SMILES notation for (4,5-dipentyl-3,6-dihydro-2H-thiopyran-2-yl)methanol?
The canonical SMILES for (4,5-dipentyl-3,6-dihydro-2H-thiopyran-2-yl)methanol is CCCCCC1=C(CCCCC)CC(CO)SC1.
What is the InChIKey of (4,5-dipentyl-3,6-dihydro-2H-thiopyran-2-yl)methanol?
The InChIKey is DZOUMQWAHKHUET-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30OS/c1-3-5-7-9-14-11-16(12-17)18-13-15(14)10-8-6-4-2/h16-17H,3-13H2,1-2H3.
What are the key properties of (4,5-dipentyl-3,6-dihydro-2H-thiopyran-2-yl)methanol?
(4,5-dipentyl-3,6-dihydro-2H-thiopyran-2-yl)methanol has a molecular weight of 270.48 g/mol, XLogP of 4.94, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dipentyl-3,6-dihydro-2H-thiopyran-2-yl)methanol is sourced from PubChem (CID 18988213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).