C24H40N2OS3 — CID 18988231
N-[6-methyl-2,4-bis(methylsulfanyl)-3-pyridinyl]-3,6-dipentylthiane-2-carboxamide (PubChem CID 18988231) has the molecular formula C24H40N2OS3 and a molecular weight of 468.80 g/mol. Its IUPAC name is N-[6-methyl-2,4-bis(methylsulfanyl)-3-pyridinyl]-3,6-dipentylthiane-2-carboxamide.
| Compound Name | N-[6-methyl-2,4-bis(methylsulfanyl)-3-pyridinyl]-3,6-dipentylthiane-2-carboxamide |
|---|---|
| PubChem CID | 18988231 |
| Molecular Formula | C24H40N2OS3 |
| Molecular Weight | 468.80 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | N-[6-methyl-2,4-bis(methylsulfanyl)-3-pyridinyl]-3,6-dipentylthiane-2-carboxamide |
| SMILES | CCCCCC1CCC(CCCCC)C(C(=O)Nc2c(SC)cc(C)nc2SC)S1 |
| InChI | InChI=1S/C24H40N2OS3/c1-6-8-10-12-18-14-15-19(13-11-9-7-2)30-22(18)23(27)26-21-20(28-4)16-17(3)25-24(21)29-5/h16,18-19,22H,6-15H2,1-5H3,(H,26,27) |
| InChIKey | GGPAAFNABJRSAG-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.80 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|