C19H36O3 — CID 18988259
3,5-diheptyloxolane-2-carboxylic acid (PubChem CID 18988259) has the molecular formula C19H36O3 and a molecular weight of 312.49 g/mol. Its IUPAC name is 3,5-diheptyloxolane-2-carboxylic acid.
| Compound Name | 3,5-diheptyloxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 18988259 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | 3,5-diheptyloxolane-2-carboxylic acid |
| SMILES | CCCCCCCC1CC(CCCCCCC)C(C(=O)O)O1 |
| InChI | InChI=1S/C19H36O3/c1-3-5-7-9-11-13-16-15-17(22-18(16)19(20)21)14-12-10-8-6-4-2/h16-18H,3-15H2,1-2H3,(H,20,21) |
| InChIKey | RSEMHYRMSLSOKX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|