About [2-(propan-2-ylamino)-1,3-thiazol-5-yl] thiocyanate
[2-(propan-2-ylamino)-1,3-thiazol-5-yl] thiocyanate (PubChem CID 18988324) has the molecular formula C7H9N3S2
and a molecular weight of 199.30 g/mol. Its IUPAC name is [2-(propan-2-ylamino)-1,3-thiazol-5-yl] thiocyanate.
Molecular Properties
| Compound Name | [2-(propan-2-ylamino)-1,3-thiazol-5-yl] thiocyanate |
| PubChem CID | 18988324 |
| Molecular Formula | C7H9N3S2 |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | [2-(propan-2-ylamino)-1,3-thiazol-5-yl] thiocyanate |
| SMILES | CC(C)Nc1ncc(SC#N)s1 |
| InChI | InChI=1S/C7H9N3S2/c1-5(2)10-7-9-3-6(12-7)11-4-8/h3,5H,1-2H3,(H,9,10) |
| InChIKey | HXLOUYPLPARLLO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [2-(propan-2-ylamino)-1,3-thiazol-5-yl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(propan-2-ylamino)-1,3-thiazol-5-yl] thiocyanate?
The IUPAC name of [2-(propan-2-ylamino)-1,3-thiazol-5-yl] thiocyanate (CID 18988324) is [2-(propan-2-ylamino)-1,3-thiazol-5-yl] thiocyanate.
What is the SMILES notation for [2-(propan-2-ylamino)-1,3-thiazol-5-yl] thiocyanate?
The canonical SMILES for [2-(propan-2-ylamino)-1,3-thiazol-5-yl] thiocyanate is CC(C)Nc1ncc(SC#N)s1.
What is the InChIKey of [2-(propan-2-ylamino)-1,3-thiazol-5-yl] thiocyanate?
The InChIKey is HXLOUYPLPARLLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3S2/c1-5(2)10-7-9-3-6(12-7)11-4-8/h3,5H,1-2H3,(H,9,10).
What are the key properties of [2-(propan-2-ylamino)-1,3-thiazol-5-yl] thiocyanate?
[2-(propan-2-ylamino)-1,3-thiazol-5-yl] thiocyanate has a molecular weight of 199.30 g/mol, XLogP of 2.54, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(propan-2-ylamino)-1,3-thiazol-5-yl] thiocyanate is sourced from PubChem (CID 18988324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).