About 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N,N-dioctylacetamide
2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N,N-dioctylacetamide (PubChem CID 18988657) has the molecular formula C30H54N2O3S
and a molecular weight of 522.84 g/mol. Its IUPAC name is 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N,N-dioctylacetamide.
Molecular Properties
| Compound Name | 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N,N-dioctylacetamide |
| PubChem CID | 18988657 |
| Molecular Formula | C30H54N2O3S |
| Molecular Weight | 522.84 g/mol |
| Exact Mass | 522.39 |
| IUPAC Name | 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N,N-dioctylacetamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)CS(=O)(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C30H54N2O3S/c1-7-9-11-13-15-17-22-32(23-18-16-14-12-10-8-2)29(33)24-36(34,35)31-30-27(25(3)4)20-19-21-28(30)26(5)6/h19-21,25-26,31H,7-18,22-24H2,1-6H3 |
| InChIKey | QIJHPTDYMCINPX-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.84 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N,N-dioctylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N,N-dioctylacetamide?
The IUPAC name of 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N,N-dioctylacetamide (CID 18988657) is 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N,N-dioctylacetamide.
What is the SMILES notation for 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N,N-dioctylacetamide?
The canonical SMILES for 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N,N-dioctylacetamide is CCCCCCCCN(CCCCCCCC)C(=O)CS(=O)(=O)Nc1c(C(C)C)cccc1C(C)C.
What is the InChIKey of 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N,N-dioctylacetamide?
The InChIKey is QIJHPTDYMCINPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H54N2O3S/c1-7-9-11-13-15-17-22-32(23-18-16-14-12-10-8-2)29(33)24-36(34,35)31-30-27(25(3)4)20-19-21-28(30)26(5)6/h19-21,25-26,31H,7-18,22-24H2,1-6H3.
What are the key properties of 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N,N-dioctylacetamide?
2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N,N-dioctylacetamide has a molecular weight of 522.84 g/mol, XLogP of 8.22, 20 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,6-di(propan-2-yl)phenyl]sulfamoyl]-N,N-dioctylacetamide is sourced from PubChem (CID 18988657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).