C22H23NO3 — CID 18989939
6-[2-(3,3,4,4,7-pentamethyl-2H-chromen-6-yl)ethynyl]pyridine-3-carboxylic acid (PubChem CID 18989939) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is 6-[2-(3,3,4,4,7-pentamethyl-2H-chromen-6-yl)ethynyl]pyridine-3-carboxylic acid.
| Compound Name | 6-[2-(3,3,4,4,7-pentamethyl-2H-chromen-6-yl)ethynyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 18989939 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 6-[2-(3,3,4,4,7-pentamethyl-2H-chromen-6-yl)ethynyl]pyridine-3-carboxylic acid |
| SMILES | Cc1cc2c(cc1C#Cc1ccc(C(=O)O)cn1)C(C)(C)C(C)(C)CO2 |
| InChI | InChI=1S/C22H23NO3/c1-14-10-19-18(22(4,5)21(2,3)13-26-19)11-15(14)6-8-17-9-7-16(12-23-17)20(24)25/h7,9-12H,13H2,1-5H3,(H,24,25) |
| InChIKey | OTTGKUDCTREYTL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|