C13H18O — CID 18989976
(2E,6E,8E)-3,7-dimethylundeca-2,6,8-trien-4-yn-1-ol (PubChem CID 18989976) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is (2E,6E,8E)-3,7-dimethylundeca-2,6,8-trien-4-yn-1-ol.
| Compound Name | (2E,6E,8E)-3,7-dimethylundeca-2,6,8-trien-4-yn-1-ol |
|---|---|
| PubChem CID | 18989976 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (2E,6E,8E)-3,7-dimethylundeca-2,6,8-trien-4-yn-1-ol |
| SMILES | CC/C=C/C(C)=C/C#C/C(C)=C/CO |
| InChI | InChI=1S/C13H18O/c1-4-5-7-12(2)8-6-9-13(3)10-11-14/h5,7-8,10,14H,4,11H2,1-3H3/b7-5+,12-8+,13-10+ |
| InChIKey | TXLPAXBLVKLQIO-WZFKEYBNSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|