C27H34O4 — CID 18990015
4-[(E)-2-(3-methoxy-5,5,8,8-tetramethyl-1-propoxy-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid (PubChem CID 18990015) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is 4-[(E)-2-(3-methoxy-5,5,8,8-tetramethyl-1-propoxy-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid.
| Compound Name | 4-[(E)-2-(3-methoxy-5,5,8,8-tetramethyl-1-propoxy-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid |
|---|---|
| PubChem CID | 18990015 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 4-[(E)-2-(3-methoxy-5,5,8,8-tetramethyl-1-propoxy-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid |
| SMILES | CCCOc1c(/C=C/c2ccc(C(=O)O)cc2)c(OC)cc2c1C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C27H34O4/c1-7-16-31-24-20(13-10-18-8-11-19(12-9-18)25(28)29)22(30-6)17-21-23(24)27(4,5)15-14-26(21,2)3/h8-13,17H,7,14-16H2,1-6H3,(H,28,29)/b13-10+ |
| InChIKey | CCQFTSHYCLCUBK-JLHYYAGUSA-N |
| XLogP | 6.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|