C10H14O2 — CID 18990173
5-(2-hydroxyethyl)-3,3a,4,6a-tetrahydro-1H-pentalen-2-one (PubChem CID 18990173) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-3,3a,4,6a-tetrahydro-1H-pentalen-2-one.
| Compound Name | 5-(2-hydroxyethyl)-3,3a,4,6a-tetrahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 18990173 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 5-(2-hydroxyethyl)-3,3a,4,6a-tetrahydro-1H-pentalen-2-one |
| SMILES | O=C1CC2C=C(CCO)CC2C1 |
| InChI | InChI=1S/C10H14O2/c11-2-1-7-3-8-5-10(12)6-9(8)4-7/h3,8-9,11H,1-2,4-6H2 |
| InChIKey | YQWPSMBJJNOXPI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|