C22H28ClN3O5 — CID 18990352
1-(4-benzylpiperazin-1-yl)-5-(3,4-dihydroxy-5-nitrophenyl)pentan-1-one;hydrochloride (PubChem CID 18990352) has the molecular formula C22H28ClN3O5 and a molecular weight of 449.94 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-5-(3,4-dihydroxy-5-nitrophenyl)pentan-1-one;hydrochloride.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-5-(3,4-dihydroxy-5-nitrophenyl)pentan-1-one;hydrochloride |
|---|---|
| PubChem CID | 18990352 |
| Molecular Formula | C22H28ClN3O5 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-5-(3,4-dihydroxy-5-nitrophenyl)pentan-1-one;hydrochloride |
| SMILES | Cl.O=C(CCCCc1cc(O)c(O)c([N+](=O)[O-])c1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H27N3O5.ClH/c26-20-15-18(14-19(22(20)28)25(29)30)8-4-5-9-21(27)24-12-10-23(11-13-24)16-17-6-2-1-3-7-17;/h1-3,6-7,14-15,26,28H,4-5,8-13,16H2;1H |
| InChIKey | VNTWJPNLLBXHIY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|