C34H20F6O5 — CID 18990580
6-[4-[1,1-bis[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]phenoxy]naphthalene-1,4-dione (PubChem CID 18990580) has the molecular formula C34H20F6O5 and a molecular weight of 622.52 g/mol. Its IUPAC name is 6-[4-[1,1-bis[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]phenoxy]naphthalene-1,4-dione.
| Compound Name | 6-[4-[1,1-bis[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]phenoxy]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 18990580 |
| Molecular Formula | C34H20F6O5 |
| Molecular Weight | 622.52 g/mol |
| Exact Mass | 622.12 |
| IUPAC Name | 6-[4-[1,1-bis[4-(1,2,2-trifluoroethenoxy)phenyl]ethyl]phenoxy]naphthalene-1,4-dione |
| SMILES | CC(c1ccc(OC(F)=C(F)F)cc1)(c1ccc(OC(F)=C(F)F)cc1)c1ccc(Oc2ccc3c(c2)C(=O)C=CC3=O)cc1 |
| InChI | InChI=1S/C34H20F6O5/c1-34(20-4-10-23(11-5-20)44-32(39)30(35)36,21-6-12-24(13-7-21)45-33(40)31(37)38)19-2-8-22(9-3-19)43-25-14-15-26-27(18-25)29(42)17-16-28(26)41/h2-18H,1H3 |
| InChIKey | AYUKWVIFIPCQTM-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.52 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|