About dioctoxy(diphenyl)silane
dioctoxy(diphenyl)silane (PubChem CID 18990706) has the molecular formula C28H44O2Si
and a molecular weight of 440.74 g/mol. Its IUPAC name is dioctoxy(diphenyl)silane.
Molecular Properties
| Compound Name | dioctoxy(diphenyl)silane |
| PubChem CID | 18990706 |
| Molecular Formula | C28H44O2Si |
| Molecular Weight | 440.74 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | dioctoxy(diphenyl)silane |
| SMILES | CCCCCCCCO[Si](OCCCCCCCC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H44O2Si/c1-3-5-7-9-11-19-25-29-31(27-21-15-13-16-22-27,28-23-17-14-18-24-28)30-26-20-12-10-8-6-4-2/h13-18,21-24H,3-12,19-20,25-26H2,1-2H3 |
| InChIKey | BQOHGKXVHXIPTN-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.74 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dioctoxy(diphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioctoxy(diphenyl)silane?
The IUPAC name of dioctoxy(diphenyl)silane (CID 18990706) is dioctoxy(diphenyl)silane.
What is the SMILES notation for dioctoxy(diphenyl)silane?
The canonical SMILES for dioctoxy(diphenyl)silane is CCCCCCCCO[Si](OCCCCCCCC)(c1ccccc1)c1ccccc1.
What is the InChIKey of dioctoxy(diphenyl)silane?
The InChIKey is BQOHGKXVHXIPTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H44O2Si/c1-3-5-7-9-11-19-25-29-31(27-21-15-13-16-22-27,28-23-17-14-18-24-28)30-26-20-12-10-8-6-4-2/h13-18,21-24H,3-12,19-20,25-26H2,1-2H3.
What are the key properties of dioctoxy(diphenyl)silane?
dioctoxy(diphenyl)silane has a molecular weight of 440.74 g/mol, XLogP of 7.00, 18 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dioctoxy(diphenyl)silane is sourced from PubChem (CID 18990706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).