C10H16Si — CID 18990725
1,1-dimethyl-2,3,4,5-tetrahydrocyclopenta[b]siline (PubChem CID 18990725) has the molecular formula C10H16Si and a molecular weight of 164.32 g/mol. Its IUPAC name is 1,1-dimethyl-2,3,4,5-tetrahydrocyclopenta[b]siline.
| Compound Name | 1,1-dimethyl-2,3,4,5-tetrahydrocyclopenta[b]siline |
|---|---|
| PubChem CID | 18990725 |
| Molecular Formula | C10H16Si |
| Molecular Weight | 164.32 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | 1,1-dimethyl-2,3,4,5-tetrahydrocyclopenta[b]siline |
| SMILES | C[Si]1(C)CCCC2=C1C=CC2 |
| InChI | InChI=1S/C10H16Si/c1-11(2)8-4-6-9-5-3-7-10(9)11/h3,7H,4-6,8H2,1-2H3 |
| InChIKey | VXOQWVGOVFCURT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|