C24H40Si3 — CID 18990733
dimethyl-bis(1,1,6-trimethyl-2,3,4,5-tetrahydrocyclopenta[b]silin-5-yl)silane (PubChem CID 18990733) has the molecular formula C24H40Si3 and a molecular weight of 412.84 g/mol. Its IUPAC name is dimethyl-bis(1,1,6-trimethyl-2,3,4,5-tetrahydrocyclopenta[b]silin-5-yl)silane.
| Compound Name | dimethyl-bis(1,1,6-trimethyl-2,3,4,5-tetrahydrocyclopenta[b]silin-5-yl)silane |
|---|---|
| PubChem CID | 18990733 |
| Molecular Formula | C24H40Si3 |
| Molecular Weight | 412.84 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | dimethyl-bis(1,1,6-trimethyl-2,3,4,5-tetrahydrocyclopenta[b]silin-5-yl)silane |
| SMILES | CC1=CC2=C(CCC[Si]2(C)C)C1[Si](C)(C)C1C(C)=CC2=C1CCC[Si]2(C)C |
| InChI | InChI=1S/C24H40Si3/c1-17-15-21-19(11-9-13-25(21,3)4)23(17)27(7,8)24-18(2)16-22-20(24)12-10-14-26(22,5)6/h15-16,23-24H,9-14H2,1-8H3 |
| InChIKey | NVQDRTPXFAANMF-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.84 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|