About N-butyl-2-[6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-methylacetamide
N-butyl-2-[6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-methylacetamide (PubChem CID 18990815) has the molecular formula C15H26N2O3
and a molecular weight of 282.38 g/mol. Its IUPAC name is N-butyl-2-[6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-methylacetamide.
Molecular Properties
| Compound Name | N-butyl-2-[6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-methylacetamide |
| PubChem CID | 18990815 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N-butyl-2-[6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-methylacetamide |
| SMILES | CCCCN(C)C(=O)CC1CC(CC#N)OC(C)(C)O1 |
| InChI | InChI=1S/C15H26N2O3/c1-5-6-9-17(4)14(18)11-13-10-12(7-8-16)19-15(2,3)20-13/h12-13H,5-7,9-11H2,1-4H3 |
| InChIKey | QIJBTYYXXHWIAQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-butyl-2-[6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-[6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-methylacetamide?
The IUPAC name of N-butyl-2-[6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-methylacetamide (CID 18990815) is N-butyl-2-[6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-methylacetamide.
What is the SMILES notation for N-butyl-2-[6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-methylacetamide?
The canonical SMILES for N-butyl-2-[6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-methylacetamide is CCCCN(C)C(=O)CC1CC(CC#N)OC(C)(C)O1.
What is the InChIKey of N-butyl-2-[6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-methylacetamide?
The InChIKey is QIJBTYYXXHWIAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O3/c1-5-6-9-17(4)14(18)11-13-10-12(7-8-16)19-15(2,3)20-13/h12-13H,5-7,9-11H2,1-4H3.
What are the key properties of N-butyl-2-[6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-methylacetamide?
N-butyl-2-[6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-methylacetamide has a molecular weight of 282.38 g/mol, XLogP of 2.46, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-[6-(cyanomethyl)-2,2-dimethyl-1,3-dioxan-4-yl]-N-methylacetamide is sourced from PubChem (CID 18990815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).