About 2-benzyl-4,5-dichloro-1,3-dihydropyridazin-6-one
2-benzyl-4,5-dichloro-1,3-dihydropyridazin-6-one (PubChem CID 18991295) has the molecular formula C11H10Cl2N2O
and a molecular weight of 257.12 g/mol. Its IUPAC name is 2-benzyl-4,5-dichloro-1,3-dihydropyridazin-6-one.
Molecular Properties
| Compound Name | 2-benzyl-4,5-dichloro-1,3-dihydropyridazin-6-one |
| PubChem CID | 18991295 |
| Molecular Formula | C11H10Cl2N2O |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 2-benzyl-4,5-dichloro-1,3-dihydropyridazin-6-one |
| SMILES | O=C1NN(Cc2ccccc2)CC(Cl)=C1Cl |
| InChI | InChI=1S/C11H10Cl2N2O/c12-9-7-15(14-11(16)10(9)13)6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,14,16) |
| InChIKey | QMLCJQJSXIZBOZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-4,5-dichloro-1,3-dihydropyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-4,5-dichloro-1,3-dihydropyridazin-6-one?
The IUPAC name of 2-benzyl-4,5-dichloro-1,3-dihydropyridazin-6-one (CID 18991295) is 2-benzyl-4,5-dichloro-1,3-dihydropyridazin-6-one.
What is the SMILES notation for 2-benzyl-4,5-dichloro-1,3-dihydropyridazin-6-one?
The canonical SMILES for 2-benzyl-4,5-dichloro-1,3-dihydropyridazin-6-one is O=C1NN(Cc2ccccc2)CC(Cl)=C1Cl.
What is the InChIKey of 2-benzyl-4,5-dichloro-1,3-dihydropyridazin-6-one?
The InChIKey is QMLCJQJSXIZBOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl2N2O/c12-9-7-15(14-11(16)10(9)13)6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,14,16).
What are the key properties of 2-benzyl-4,5-dichloro-1,3-dihydropyridazin-6-one?
2-benzyl-4,5-dichloro-1,3-dihydropyridazin-6-one has a molecular weight of 257.12 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-4,5-dichloro-1,3-dihydropyridazin-6-one is sourced from PubChem (CID 18991295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).