About 6,11-bis[4-(3-hydroxypropyl)phenoxy]-8-phenylsulfanyltetracene-5,12-dione
6,11-bis[4-(3-hydroxypropyl)phenoxy]-8-phenylsulfanyltetracene-5,12-dione (PubChem CID 18991439) has the molecular formula C42H34O6S
and a molecular weight of 666.79 g/mol. Its IUPAC name is 6,11-bis[4-(3-hydroxypropyl)phenoxy]-8-phenylsulfanyltetracene-5,12-dione.
Molecular Properties
| Compound Name | 6,11-bis[4-(3-hydroxypropyl)phenoxy]-8-phenylsulfanyltetracene-5,12-dione |
| PubChem CID | 18991439 |
| Molecular Formula | C42H34O6S |
| Molecular Weight | 666.79 g/mol |
| Exact Mass | 666.21 |
| IUPAC Name | 6,11-bis[4-(3-hydroxypropyl)phenoxy]-8-phenylsulfanyltetracene-5,12-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1c(Oc1ccc(CCCO)cc1)c1ccc(Sc3ccccc3)cc1c2Oc1ccc(CCCO)cc1 |
| InChI | InChI=1S/C42H34O6S/c43-24-6-8-27-14-18-29(19-15-27)47-41-35-23-22-32(49-31-10-2-1-3-11-31)26-36(35)42(48-30-20-16-28(17-21-30)9-7-25-44)38-37(41)39(45)33-12-4-5-13-34(33)40(38)46/h1-5,10-23,26,43-44H,6-9,24-25H2 |
| InChIKey | YGFGLJFVJFSPNX-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 666.79 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 6,11-bis[4-(3-hydroxypropyl)phenoxy]-8-phenylsulfanyltetracene-5,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,11-bis[4-(3-hydroxypropyl)phenoxy]-8-phenylsulfanyltetracene-5,12-dione?
The IUPAC name of 6,11-bis[4-(3-hydroxypropyl)phenoxy]-8-phenylsulfanyltetracene-5,12-dione (CID 18991439) is 6,11-bis[4-(3-hydroxypropyl)phenoxy]-8-phenylsulfanyltetracene-5,12-dione.
What is the SMILES notation for 6,11-bis[4-(3-hydroxypropyl)phenoxy]-8-phenylsulfanyltetracene-5,12-dione?
The canonical SMILES for 6,11-bis[4-(3-hydroxypropyl)phenoxy]-8-phenylsulfanyltetracene-5,12-dione is O=C1c2ccccc2C(=O)c2c1c(Oc1ccc(CCCO)cc1)c1ccc(Sc3ccccc3)cc1c2Oc1ccc(CCCO)cc1.
What is the InChIKey of 6,11-bis[4-(3-hydroxypropyl)phenoxy]-8-phenylsulfanyltetracene-5,12-dione?
The InChIKey is YGFGLJFVJFSPNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H34O6S/c43-24-6-8-27-14-18-29(19-15-27)47-41-35-23-22-32(49-31-10-2-1-3-11-31)26-36(35)42(48-30-20-16-28(17-21-30)9-7-25-44)38-37(41)39(45)33-12-4-5-13-34(33)40(38)46/h1-5,10-23,26,43-44H,6-9,24-25H2.
What are the key properties of 6,11-bis[4-(3-hydroxypropyl)phenoxy]-8-phenylsulfanyltetracene-5,12-dione?
6,11-bis[4-(3-hydroxypropyl)phenoxy]-8-phenylsulfanyltetracene-5,12-dione has a molecular weight of 666.79 g/mol, XLogP of 9.20, 12 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6,11-bis[4-(3-hydroxypropyl)phenoxy]-8-phenylsulfanyltetracene-5,12-dione is sourced from PubChem (CID 18991439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).