About disulfonylmethane
disulfonylmethane (PubChem CID 18991891) has the molecular formula CO4S2
and a molecular weight of 140.14 g/mol. Its IUPAC name is disulfonylmethane.
Molecular Properties
| Compound Name | disulfonylmethane |
| PubChem CID | 18991891 |
| Molecular Formula | CO4S2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 139.92 |
| IUPAC Name | disulfonylmethane |
| SMILES | O=S(=O)=C=S(=O)=O |
| InChI | InChI=1S/CO4S2/c2-6(3)1-7(4)5 |
| InChIKey | HOKNTYWEKQQKGV-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze disulfonylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disulfonylmethane?
The IUPAC name of disulfonylmethane (CID 18991891) is disulfonylmethane.
What is the SMILES notation for disulfonylmethane?
The canonical SMILES for disulfonylmethane is O=S(=O)=C=S(=O)=O.
What is the InChIKey of disulfonylmethane?
The InChIKey is HOKNTYWEKQQKGV-UHFFFAOYSA-N. The full InChI is InChI=1S/CO4S2/c2-6(3)1-7(4)5.
What are the key properties of disulfonylmethane?
disulfonylmethane has a molecular weight of 140.14 g/mol, XLogP of -1.62, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disulfonylmethane is sourced from PubChem (CID 18991891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).