C15H16N2O2 — CID 18992440
6,7-dimethoxy-2,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,10,13-pentaene (PubChem CID 18992440) has the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. Its IUPAC name is 6,7-dimethoxy-2,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,10,13-pentaene.
| Compound Name | 6,7-dimethoxy-2,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,10,13-pentaene |
|---|---|
| PubChem CID | 18992440 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 6,7-dimethoxy-2,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8,10,13-pentaene |
| SMILES | COc1cc2c(cc1OC)N=C1C3C=CC(C3)N1C2 |
| InChI | InChI=1S/C15H16N2O2/c1-18-13-6-10-8-17-11-4-3-9(5-11)15(17)16-12(10)7-14(13)19-2/h3-4,6-7,9,11H,5,8H2,1-2H3 |
| InChIKey | GSELITRLXGWPRN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|