About 1,3-dichloro-7-fluoropyrido[2,1-b]quinazolin-11-imine
1,3-dichloro-7-fluoropyrido[2,1-b]quinazolin-11-imine (PubChem CID 18992977) has the molecular formula C12H6Cl2FN3
and a molecular weight of 282.11 g/mol. Its IUPAC name is 1,3-dichloro-7-fluoropyrido[2,1-b]quinazolin-11-imine.
Molecular Properties
| Compound Name | 1,3-dichloro-7-fluoropyrido[2,1-b]quinazolin-11-imine |
| PubChem CID | 18992977 |
| Molecular Formula | C12H6Cl2FN3 |
| Molecular Weight | 282.11 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | 1,3-dichloro-7-fluoropyrido[2,1-b]quinazolin-11-imine |
| SMILES | [H]/N=c1/c2c(Cl)cc(Cl)cc2nc2cc(F)ccn12 |
| InChI | InChI=1S/C12H6Cl2FN3/c13-6-3-8(14)11-9(4-6)17-10-5-7(15)1-2-18(10)12(11)16/h1-5,16H/b16-12- |
| InChIKey | HCEDFUCMNMMTDH-VBKFSLOCSA-N |
| XLogP | 3.41 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.11 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichloro-7-fluoropyrido[2,1-b]quinazolin-11-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloro-7-fluoropyrido[2,1-b]quinazolin-11-imine?
The IUPAC name of 1,3-dichloro-7-fluoropyrido[2,1-b]quinazolin-11-imine (CID 18992977) is 1,3-dichloro-7-fluoropyrido[2,1-b]quinazolin-11-imine.
What is the SMILES notation for 1,3-dichloro-7-fluoropyrido[2,1-b]quinazolin-11-imine?
The canonical SMILES for 1,3-dichloro-7-fluoropyrido[2,1-b]quinazolin-11-imine is [H]/N=c1/c2c(Cl)cc(Cl)cc2nc2cc(F)ccn12.
What is the InChIKey of 1,3-dichloro-7-fluoropyrido[2,1-b]quinazolin-11-imine?
The InChIKey is HCEDFUCMNMMTDH-VBKFSLOCSA-N. The full InChI is InChI=1S/C12H6Cl2FN3/c13-6-3-8(14)11-9(4-6)17-10-5-7(15)1-2-18(10)12(11)16/h1-5,16H/b16-12-.
What are the key properties of 1,3-dichloro-7-fluoropyrido[2,1-b]quinazolin-11-imine?
1,3-dichloro-7-fluoropyrido[2,1-b]quinazolin-11-imine has a molecular weight of 282.11 g/mol, XLogP of 3.41, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-7-fluoropyrido[2,1-b]quinazolin-11-imine is sourced from PubChem (CID 18992977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).