C35H38N4O4 — CID 18992992
[3-(dimethylamino)phenyl] N-[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamate (PubChem CID 18992992) has the molecular formula C35H38N4O4 and a molecular weight of 578.71 g/mol. Its IUPAC name is [3-(dimethylamino)phenyl] N-[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamate.
| Compound Name | [3-(dimethylamino)phenyl] N-[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 18992992 |
| Molecular Formula | C35H38N4O4 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | [3-(dimethylamino)phenyl] N-[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamate |
| SMILES | CN(C)c1cccc(OC(=O)NC2C(=O)N(CC34CC5CC(CC(C5)C3)C4)c3ccccc3N(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C35H38N4O4/c1-37(2)27-11-8-12-28(18-27)43-34(42)36-31-32(40)38(22-35-19-23-15-24(20-35)17-25(16-23)21-35)29-13-6-7-14-30(29)39(33(31)41)26-9-4-3-5-10-26/h3-14,18,23-25,31H,15-17,19-22H2,1-2H3,(H,36,42) |
| InChIKey | QEAMHUYXSFUOFH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|