C32H62N8O — CID 18993528
2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]-methylamino]ethanol (PubChem CID 18993528) has the molecular formula C32H62N8O and a molecular weight of 574.90 g/mol. Its IUPAC name is 2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]-methylamino]ethanol.
| Compound Name | 2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]-methylamino]ethanol |
|---|---|
| PubChem CID | 18993528 |
| Molecular Formula | C32H62N8O |
| Molecular Weight | 574.90 g/mol |
| Exact Mass | 574.50 |
| IUPAC Name | 2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]-methylamino]ethanol |
| SMILES | CCCCN(c1nc(N(C)CCO)nc(N(CCCC)C2CC(C)(C)NC(C)(C)C2)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C32H62N8O/c1-12-14-16-39(24-20-29(3,4)36-30(5,6)21-24)27-33-26(38(11)18-19-41)34-28(35-27)40(17-15-13-2)25-22-31(7,8)37-32(9,10)23-25/h24-25,36-37,41H,12-23H2,1-11H3 |
| InChIKey | BDARHZAILAHQSO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.90 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |