About 1-cyclohexylethanethiol
1-cyclohexylethanethiol (PubChem CID 18994009) has the molecular formula C8H16S
and a molecular weight of 144.28 g/mol. Its IUPAC name is 1-cyclohexylethanethiol.
Molecular Properties
| Compound Name | 1-cyclohexylethanethiol |
| PubChem CID | 18994009 |
| Molecular Formula | C8H16S |
| Molecular Weight | 144.28 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | 1-cyclohexylethanethiol |
| SMILES | CC(S)C1CCCCC1 |
| InChI | InChI=1S/C8H16S/c1-7(9)8-5-3-2-4-6-8/h7-9H,2-6H2,1H3 |
| InChIKey | ZXQYPARNFOKKKR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexylethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylethanethiol?
The IUPAC name of 1-cyclohexylethanethiol (CID 18994009) is 1-cyclohexylethanethiol.
What is the SMILES notation for 1-cyclohexylethanethiol?
The canonical SMILES for 1-cyclohexylethanethiol is CC(S)C1CCCCC1.
What is the InChIKey of 1-cyclohexylethanethiol?
The InChIKey is ZXQYPARNFOKKKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16S/c1-7(9)8-5-3-2-4-6-8/h7-9H,2-6H2,1H3.
What are the key properties of 1-cyclohexylethanethiol?
1-cyclohexylethanethiol has a molecular weight of 144.28 g/mol, XLogP of 2.88, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylethanethiol is sourced from PubChem (CID 18994009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).