About 6-phenyl-1,2-dihydropyrimidine
6-phenyl-1,2-dihydropyrimidine (PubChem CID 18994298) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 6-phenyl-1,2-dihydropyrimidine.
Molecular Properties
| Compound Name | 6-phenyl-1,2-dihydropyrimidine |
| PubChem CID | 18994298 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 6-phenyl-1,2-dihydropyrimidine |
| SMILES | C1=NCNC(c2ccccc2)=C1 |
| InChI | InChI=1S/C10H10N2/c1-2-4-9(5-3-1)10-6-7-11-8-12-10/h1-7,12H,8H2 |
| InChIKey | KDEZCJPVLCUQOA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-phenyl-1,2-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-1,2-dihydropyrimidine?
The IUPAC name of 6-phenyl-1,2-dihydropyrimidine (CID 18994298) is 6-phenyl-1,2-dihydropyrimidine.
What is the SMILES notation for 6-phenyl-1,2-dihydropyrimidine?
The canonical SMILES for 6-phenyl-1,2-dihydropyrimidine is C1=NCNC(c2ccccc2)=C1.
What is the InChIKey of 6-phenyl-1,2-dihydropyrimidine?
The InChIKey is KDEZCJPVLCUQOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c1-2-4-9(5-3-1)10-6-7-11-8-12-10/h1-7,12H,8H2.
What are the key properties of 6-phenyl-1,2-dihydropyrimidine?
6-phenyl-1,2-dihydropyrimidine has a molecular weight of 158.20 g/mol, XLogP of 1.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-1,2-dihydropyrimidine is sourced from PubChem (CID 18994298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).