About 7,8-difluoro-1-methyl-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one
7,8-difluoro-1-methyl-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one (PubChem CID 18994580) has the molecular formula C18H15F2N3O2
and a molecular weight of 343.33 g/mol. Its IUPAC name is 7,8-difluoro-1-methyl-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one.
Molecular Properties
| Compound Name | 7,8-difluoro-1-methyl-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one |
| PubChem CID | 18994580 |
| Molecular Formula | C18H15F2N3O2 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 7,8-difluoro-1-methyl-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one |
| SMILES | Cn1cc(C(=O)N2CCCC2)c(=O)c2cc3cc(F)c(F)cc3nc21 |
| InChI | InChI=1S/C18H15F2N3O2/c1-22-9-12(18(25)23-4-2-3-5-23)16(24)11-6-10-7-13(19)14(20)8-15(10)21-17(11)22/h6-9H,2-5H2,1H3 |
| InChIKey | ZFXXVJAWWMENBZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 7,8-difluoro-1-methyl-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-difluoro-1-methyl-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one?
The IUPAC name of 7,8-difluoro-1-methyl-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one (CID 18994580) is 7,8-difluoro-1-methyl-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one.
What is the SMILES notation for 7,8-difluoro-1-methyl-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one?
The canonical SMILES for 7,8-difluoro-1-methyl-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one is Cn1cc(C(=O)N2CCCC2)c(=O)c2cc3cc(F)c(F)cc3nc21.
What is the InChIKey of 7,8-difluoro-1-methyl-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one?
The InChIKey is ZFXXVJAWWMENBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F2N3O2/c1-22-9-12(18(25)23-4-2-3-5-23)16(24)11-6-10-7-13(19)14(20)8-15(10)21-17(11)22/h6-9H,2-5H2,1H3.
What are the key properties of 7,8-difluoro-1-methyl-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one?
7,8-difluoro-1-methyl-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one has a molecular weight of 343.33 g/mol, XLogP of 2.60, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-difluoro-1-methyl-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one is sourced from PubChem (CID 18994580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).