About 1-ethyl-7,8-difluoro-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one
1-ethyl-7,8-difluoro-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one (PubChem CID 18994604) has the molecular formula C19H17F2N3O2
and a molecular weight of 357.36 g/mol. Its IUPAC name is 1-ethyl-7,8-difluoro-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one.
Molecular Properties
| Compound Name | 1-ethyl-7,8-difluoro-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one |
| PubChem CID | 18994604 |
| Molecular Formula | C19H17F2N3O2 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-ethyl-7,8-difluoro-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one |
| SMILES | CCn1cc(C(=O)N2CCCC2)c(=O)c2cc3cc(F)c(F)cc3nc21 |
| InChI | InChI=1S/C19H17F2N3O2/c1-2-23-10-13(19(26)24-5-3-4-6-24)17(25)12-7-11-8-14(20)15(21)9-16(11)22-18(12)23/h7-10H,2-6H2,1H3 |
| InChIKey | VQDJFLBVIUXRMG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-7,8-difluoro-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-7,8-difluoro-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one?
The IUPAC name of 1-ethyl-7,8-difluoro-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one (CID 18994604) is 1-ethyl-7,8-difluoro-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one.
What is the SMILES notation for 1-ethyl-7,8-difluoro-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one?
The canonical SMILES for 1-ethyl-7,8-difluoro-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one is CCn1cc(C(=O)N2CCCC2)c(=O)c2cc3cc(F)c(F)cc3nc21.
What is the InChIKey of 1-ethyl-7,8-difluoro-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one?
The InChIKey is VQDJFLBVIUXRMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F2N3O2/c1-2-23-10-13(19(26)24-5-3-4-6-24)17(25)12-7-11-8-14(20)15(21)9-16(11)22-18(12)23/h7-10H,2-6H2,1H3.
What are the key properties of 1-ethyl-7,8-difluoro-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one?
1-ethyl-7,8-difluoro-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one has a molecular weight of 357.36 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-7,8-difluoro-3-(pyrrolidine-1-carbonyl)benzo[b][1,8]naphthyridin-4-one is sourced from PubChem (CID 18994604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).