About imidazo[4,5-c]quinoline-4-thione
imidazo[4,5-c]quinoline-4-thione (PubChem CID 18994621) has the molecular formula C10H5N3S
and a molecular weight of 199.24 g/mol. Its IUPAC name is imidazo[4,5-c]quinoline-4-thione.
Molecular Properties
| Compound Name | imidazo[4,5-c]quinoline-4-thione |
| PubChem CID | 18994621 |
| Molecular Formula | C10H5N3S |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | imidazo[4,5-c]quinoline-4-thione |
| SMILES | S=C1N=c2ccccc2=C2N=CN=C12 |
| InChI | InChI=1S/C10H5N3S/c14-10-9-8(11-5-12-9)6-3-1-2-4-7(6)13-10/h1-5H |
| InChIKey | BSNIOFUNVFGSFP-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze imidazo[4,5-c]quinoline-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[4,5-c]quinoline-4-thione?
The IUPAC name of imidazo[4,5-c]quinoline-4-thione (CID 18994621) is imidazo[4,5-c]quinoline-4-thione.
What is the SMILES notation for imidazo[4,5-c]quinoline-4-thione?
The canonical SMILES for imidazo[4,5-c]quinoline-4-thione is S=C1N=c2ccccc2=C2N=CN=C12.
What is the InChIKey of imidazo[4,5-c]quinoline-4-thione?
The InChIKey is BSNIOFUNVFGSFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5N3S/c14-10-9-8(11-5-12-9)6-3-1-2-4-7(6)13-10/h1-5H.
What are the key properties of imidazo[4,5-c]quinoline-4-thione?
imidazo[4,5-c]quinoline-4-thione has a molecular weight of 199.24 g/mol, XLogP of 0.24, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[4,5-c]quinoline-4-thione is sourced from PubChem (CID 18994621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).