C28H38F2N8 — CID 18994745
5-[1-[4-[[5-butyl-3-(1,1-difluoropentyl)-1,2,4-triazol-1-yl]methyl]phenyl]-3-pentylpyrrol-2-yl]-2H-tetrazole (PubChem CID 18994745) has the molecular formula C28H38F2N8 and a molecular weight of 524.66 g/mol. Its IUPAC name is 5-[1-[4-[[5-butyl-3-(1,1-difluoropentyl)-1,2,4-triazol-1-yl]methyl]phenyl]-3-pentylpyrrol-2-yl]-2H-tetrazole.
| Compound Name | 5-[1-[4-[[5-butyl-3-(1,1-difluoropentyl)-1,2,4-triazol-1-yl]methyl]phenyl]-3-pentylpyrrol-2-yl]-2H-tetrazole |
|---|---|
| PubChem CID | 18994745 |
| Molecular Formula | C28H38F2N8 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | 5-[1-[4-[[5-butyl-3-(1,1-difluoropentyl)-1,2,4-triazol-1-yl]methyl]phenyl]-3-pentylpyrrol-2-yl]-2H-tetrazole |
| SMILES | CCCCCc1ccn(-c2ccc(Cn3nc(C(F)(F)CCCC)nc3CCCC)cc2)c1-c1nn[nH]n1 |
| InChI | InChI=1S/C28H38F2N8/c1-4-7-10-11-22-17-19-37(25(22)26-32-35-36-33-26)23-15-13-21(14-16-23)20-38-24(12-8-5-2)31-27(34-38)28(29,30)18-9-6-3/h13-17,19H,4-12,18,20H2,1-3H3,(H,32,33,35,36) |
| InChIKey | FTENKXKXVMWONI-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|