C27H36F2N8 — CID 18994838
5-[1-[4-[[5-butyl-3-(1,1-difluorobutyl)-1,2,4-triazol-1-yl]methyl]phenyl]-3-pentylpyrrol-2-yl]-2H-tetrazole (PubChem CID 18994838) has the molecular formula C27H36F2N8 and a molecular weight of 510.64 g/mol. Its IUPAC name is 5-[1-[4-[[5-butyl-3-(1,1-difluorobutyl)-1,2,4-triazol-1-yl]methyl]phenyl]-3-pentylpyrrol-2-yl]-2H-tetrazole.
| Compound Name | 5-[1-[4-[[5-butyl-3-(1,1-difluorobutyl)-1,2,4-triazol-1-yl]methyl]phenyl]-3-pentylpyrrol-2-yl]-2H-tetrazole |
|---|---|
| PubChem CID | 18994838 |
| Molecular Formula | C27H36F2N8 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | 5-[1-[4-[[5-butyl-3-(1,1-difluorobutyl)-1,2,4-triazol-1-yl]methyl]phenyl]-3-pentylpyrrol-2-yl]-2H-tetrazole |
| SMILES | CCCCCc1ccn(-c2ccc(Cn3nc(C(F)(F)CCC)nc3CCCC)cc2)c1-c1nn[nH]n1 |
| InChI | InChI=1S/C27H36F2N8/c1-4-7-9-10-21-16-18-36(24(21)25-31-34-35-32-25)22-14-12-20(13-15-22)19-37-23(11-8-5-2)30-26(33-37)27(28,29)17-6-3/h12-16,18H,4-11,17,19H2,1-3H3,(H,31,32,34,35) |
| InChIKey | VXJFCIUVOZOZPO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|