About 1,4-dibutyltriazole
1,4-dibutyltriazole (PubChem CID 18994978) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is 1,4-dibutyltriazole.
Molecular Properties
| Compound Name | 1,4-dibutyltriazole |
| PubChem CID | 18994978 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 1,4-dibutyltriazole |
| SMILES | CCCCc1cn(CCCC)nn1 |
| InChI | InChI=1S/C10H19N3/c1-3-5-7-10-9-13(12-11-10)8-6-4-2/h9H,3-8H2,1-2H3 |
| InChIKey | HEFCHGSECOFDKD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,4-dibutyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dibutyltriazole?
The IUPAC name of 1,4-dibutyltriazole (CID 18994978) is 1,4-dibutyltriazole.
What is the SMILES notation for 1,4-dibutyltriazole?
The canonical SMILES for 1,4-dibutyltriazole is CCCCc1cn(CCCC)nn1.
What is the InChIKey of 1,4-dibutyltriazole?
The InChIKey is HEFCHGSECOFDKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3/c1-3-5-7-10-9-13(12-11-10)8-6-4-2/h9H,3-8H2,1-2H3.
What are the key properties of 1,4-dibutyltriazole?
1,4-dibutyltriazole has a molecular weight of 181.28 g/mol, XLogP of 2.42, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dibutyltriazole is sourced from PubChem (CID 18994978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).