C18H17ClN10O4 — CID 18995099
5-[1-[4-[(3-butyl-5-chloro-1,2,4-triazol-1-yl)methyl]phenyl]-3,5-dinitropyrrol-2-yl]-2H-tetrazole (PubChem CID 18995099) has the molecular formula C18H17ClN10O4 and a molecular weight of 472.85 g/mol. Its IUPAC name is 5-[1-[4-[(3-butyl-5-chloro-1,2,4-triazol-1-yl)methyl]phenyl]-3,5-dinitropyrrol-2-yl]-2H-tetrazole.
| Compound Name | 5-[1-[4-[(3-butyl-5-chloro-1,2,4-triazol-1-yl)methyl]phenyl]-3,5-dinitropyrrol-2-yl]-2H-tetrazole |
|---|---|
| PubChem CID | 18995099 |
| Molecular Formula | C18H17ClN10O4 |
| Molecular Weight | 472.85 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 5-[1-[4-[(3-butyl-5-chloro-1,2,4-triazol-1-yl)methyl]phenyl]-3,5-dinitropyrrol-2-yl]-2H-tetrazole |
| SMILES | CCCCc1nc(Cl)n(Cc2ccc(-n3c([N+](=O)[O-])cc([N+](=O)[O-])c3-c3nn[nH]n3)cc2)n1 |
| InChI | InChI=1S/C18H17ClN10O4/c1-2-3-4-14-20-18(19)26(23-14)10-11-5-7-12(8-6-11)27-15(29(32)33)9-13(28(30)31)16(27)17-21-24-25-22-17/h5-9H,2-4,10H2,1H3,(H,21,22,24,25) |
| InChIKey | UJZAMQCAUNYPAX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 176.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.85 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|