C27H38N8 — CID 18995170
5-[1-[4-[[3,5-bis(2-methylpropyl)-1,2,4-triazol-1-yl]methyl]phenyl]-5-pentylpyrrol-2-yl]-2H-tetrazole (PubChem CID 18995170) has the molecular formula C27H38N8 and a molecular weight of 474.66 g/mol. Its IUPAC name is 5-[1-[4-[[3,5-bis(2-methylpropyl)-1,2,4-triazol-1-yl]methyl]phenyl]-5-pentylpyrrol-2-yl]-2H-tetrazole.
| Compound Name | 5-[1-[4-[[3,5-bis(2-methylpropyl)-1,2,4-triazol-1-yl]methyl]phenyl]-5-pentylpyrrol-2-yl]-2H-tetrazole |
|---|---|
| PubChem CID | 18995170 |
| Molecular Formula | C27H38N8 |
| Molecular Weight | 474.66 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | 5-[1-[4-[[3,5-bis(2-methylpropyl)-1,2,4-triazol-1-yl]methyl]phenyl]-5-pentylpyrrol-2-yl]-2H-tetrazole |
| SMILES | CCCCCc1ccc(-c2nn[nH]n2)n1-c1ccc(Cn2nc(CC(C)C)nc2CC(C)C)cc1 |
| InChI | InChI=1S/C27H38N8/c1-6-7-8-9-22-14-15-24(27-29-32-33-30-27)35(22)23-12-10-21(11-13-23)18-34-26(17-20(4)5)28-25(31-34)16-19(2)3/h10-15,19-20H,6-9,16-18H2,1-5H3,(H,29,30,32,33) |
| InChIKey | GURWWZCBUXFXCW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.66 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|