About 4,4-diphenyl-3H-oxathiine
4,4-diphenyl-3H-oxathiine (PubChem CID 18995298) has the molecular formula C16H14OS
and a molecular weight of 254.35 g/mol. Its IUPAC name is 4,4-diphenyl-3H-oxathiine.
Molecular Properties
| Compound Name | 4,4-diphenyl-3H-oxathiine |
| PubChem CID | 18995298 |
| Molecular Formula | C16H14OS |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 4,4-diphenyl-3H-oxathiine |
| SMILES | C1=CC(c2ccccc2)(c2ccccc2)CSO1 |
| InChI | InChI=1S/C16H14OS/c1-3-7-14(8-4-1)16(11-12-17-18-13-16)15-9-5-2-6-10-15/h1-12H,13H2 |
| InChIKey | WXBQGPSFOHTLMG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,4-diphenyl-3H-oxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-diphenyl-3H-oxathiine?
The IUPAC name of 4,4-diphenyl-3H-oxathiine (CID 18995298) is 4,4-diphenyl-3H-oxathiine.
What is the SMILES notation for 4,4-diphenyl-3H-oxathiine?
The canonical SMILES for 4,4-diphenyl-3H-oxathiine is C1=CC(c2ccccc2)(c2ccccc2)CSO1.
What is the InChIKey of 4,4-diphenyl-3H-oxathiine?
The InChIKey is WXBQGPSFOHTLMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14OS/c1-3-7-14(8-4-1)16(11-12-17-18-13-16)15-9-5-2-6-10-15/h1-12H,13H2.
What are the key properties of 4,4-diphenyl-3H-oxathiine?
4,4-diphenyl-3H-oxathiine has a molecular weight of 254.35 g/mol, XLogP of 4.16, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diphenyl-3H-oxathiine is sourced from PubChem (CID 18995298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).