About 5-amino-4-dodecyl-1,3-dioxan-2-one
5-amino-4-dodecyl-1,3-dioxan-2-one (PubChem CID 18996060) has the molecular formula C16H31NO3
and a molecular weight of 285.43 g/mol. Its IUPAC name is 5-amino-4-dodecyl-1,3-dioxan-2-one.
Molecular Properties
| Compound Name | 5-amino-4-dodecyl-1,3-dioxan-2-one |
| PubChem CID | 18996060 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | 5-amino-4-dodecyl-1,3-dioxan-2-one |
| SMILES | CCCCCCCCCCCCC1OC(=O)OCC1N |
| InChI | InChI=1S/C16H31NO3/c1-2-3-4-5-6-7-8-9-10-11-12-15-14(17)13-19-16(18)20-15/h14-15H,2-13,17H2,1H3 |
| InChIKey | VOGWCVGUTCBHCY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-4-dodecyl-1,3-dioxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-dodecyl-1,3-dioxan-2-one?
The IUPAC name of 5-amino-4-dodecyl-1,3-dioxan-2-one (CID 18996060) is 5-amino-4-dodecyl-1,3-dioxan-2-one.
What is the SMILES notation for 5-amino-4-dodecyl-1,3-dioxan-2-one?
The canonical SMILES for 5-amino-4-dodecyl-1,3-dioxan-2-one is CCCCCCCCCCCCC1OC(=O)OCC1N.
What is the InChIKey of 5-amino-4-dodecyl-1,3-dioxan-2-one?
The InChIKey is VOGWCVGUTCBHCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO3/c1-2-3-4-5-6-7-8-9-10-11-12-15-14(17)13-19-16(18)20-15/h14-15H,2-13,17H2,1H3.
What are the key properties of 5-amino-4-dodecyl-1,3-dioxan-2-one?
5-amino-4-dodecyl-1,3-dioxan-2-one has a molecular weight of 285.43 g/mol, XLogP of 4.16, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-dodecyl-1,3-dioxan-2-one is sourced from PubChem (CID 18996060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).